C14H22 — CID 144917186
ethane;(3Z,5E)-4-methyl-5-prop-1-en-2-ylocta-1,3,5,7-tetraene (PubChem CID 144917186) has the molecular formula C14H22 and a molecular weight of 190.33 g/mol. Its IUPAC name is ethane;(3Z,5E)-4-methyl-5-prop-1-en-2-ylocta-1,3,5,7-tetraene.
| Compound Name | ethane;(3Z,5E)-4-methyl-5-prop-1-en-2-ylocta-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 144917186 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | ethane;(3Z,5E)-4-methyl-5-prop-1-en-2-ylocta-1,3,5,7-tetraene |
| SMILES | C=C/C=C(C)\C(=C\C=C)C(=C)C.CC |
| InChI | InChI=1S/C12H16.C2H6/c1-6-8-11(5)12(9-7-2)10(3)4;1-2/h6-9H,1-3H2,4-5H3;1-2H3/b11-8-,12-9+; |
| InChIKey | QPOKQOVXYMJJSD-MJZQZBGRSA-N |
| XLogP | 4.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|