C11H21F — CID 143773751
ethane;(3Z)-2-fluoro-3-methylhexa-1,3,5-triene (PubChem CID 143773751) has the molecular formula C11H21F and a molecular weight of 172.29 g/mol. Its IUPAC name is ethane;(3Z)-2-fluoro-3-methylhexa-1,3,5-triene.
| Compound Name | ethane;(3Z)-2-fluoro-3-methylhexa-1,3,5-triene |
|---|---|
| PubChem CID | 143773751 |
| Molecular Formula | C11H21F |
| Molecular Weight | 172.29 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | ethane;(3Z)-2-fluoro-3-methylhexa-1,3,5-triene |
| SMILES | C=C/C=C(/C)C(=C)F.CC.CC |
| InChI | InChI=1S/C7H9F.2C2H6/c1-4-5-6(2)7(3)8;2*1-2/h4-5H,1,3H2,2H3;2*1-2H3/b6-5-;; |
| InChIKey | QGEILPZZPRGYCT-XNOMRPDFSA-N |
| XLogP | 4.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.29 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|