C14H28 — CID 156821319
(3E,5E)-4,5-dimethylhepta-1,3,5-triene;ethane;propane (PubChem CID 156821319) has the molecular formula C14H28 and a molecular weight of 196.38 g/mol. Its IUPAC name is (3E,5E)-4,5-dimethylhepta-1,3,5-triene;ethane;propane.
| Compound Name | (3E,5E)-4,5-dimethylhepta-1,3,5-triene;ethane;propane |
|---|---|
| PubChem CID | 156821319 |
| Molecular Formula | C14H28 |
| Molecular Weight | 196.38 g/mol |
| Exact Mass | 196.22 |
| IUPAC Name | (3E,5E)-4,5-dimethylhepta-1,3,5-triene;ethane;propane |
| SMILES | C=C/C=C(C)/C(C)=C/C.CC.CCC |
| InChI | InChI=1S/C9H14.C3H8.C2H6/c1-5-7-9(4)8(3)6-2;1-3-2;1-2/h5-7H,1H2,2-4H3;3H2,1-2H3;1-2H3/b8-6+,9-7+;; |
| InChIKey | LQCHTNVCFTWEEY-IWBCLEKBSA-N |
| XLogP | 5.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.38 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|