C8H17N — CID 143277472
(2E)-penta-2,4-dien-2-amine;propane (PubChem CID 143277472) has the molecular formula C8H17N and a molecular weight of 127.23 g/mol. Its IUPAC name is (2E)-penta-2,4-dien-2-amine;propane.
| Compound Name | (2E)-penta-2,4-dien-2-amine;propane |
|---|---|
| PubChem CID | 143277472 |
| Molecular Formula | C8H17N |
| Molecular Weight | 127.23 g/mol |
| Exact Mass | 127.14 |
| IUPAC Name | (2E)-penta-2,4-dien-2-amine;propane |
| SMILES | C=C/C=C(\C)N.CCC |
| InChI | InChI=1S/C5H9N.C3H8/c1-3-4-5(2)6;1-3-2/h3-4H,1,6H2,2H3;3H2,1-2H3/b5-4+; |
| InChIKey | RTYNEFVBWCPEQW-FXRZFVDSSA-N |
| XLogP | 2.45 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.23 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|