About (Z)-but-2-en-2-amine;ethane;ethenamine
(Z)-but-2-en-2-amine;ethane;ethenamine (PubChem CID 143379680) has the molecular formula C10H26N2
and a molecular weight of 174.33 g/mol. Its IUPAC name is (Z)-but-2-en-2-amine;ethane;ethenamine.
Molecular Properties
| Compound Name | (Z)-but-2-en-2-amine;ethane;ethenamine |
| PubChem CID | 143379680 |
| Molecular Formula | C10H26N2 |
| Molecular Weight | 174.33 g/mol |
| Exact Mass | 174.21 |
| IUPAC Name | (Z)-but-2-en-2-amine;ethane;ethenamine |
| SMILES | C/C=C(/C)N.C=CN.CC.CC |
| InChI | InChI=1S/C4H9N.C2H5N.2C2H6/c1-3-4(2)5;1-2-3;2*1-2/h3H,5H2,1-2H3;2H,1,3H2;2*1-2H3/b4-3-;;; |
| InChIKey | QKEBQWLTRQHJPY-FGSKAQBVSA-N |
| XLogP | 3.01 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (Z)-but-2-en-2-amine;ethane;ethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-but-2-en-2-amine;ethane;ethenamine?
The IUPAC name of (Z)-but-2-en-2-amine;ethane;ethenamine (CID 143379680) is (Z)-but-2-en-2-amine;ethane;ethenamine.
What is the SMILES notation for (Z)-but-2-en-2-amine;ethane;ethenamine?
The canonical SMILES for (Z)-but-2-en-2-amine;ethane;ethenamine is C/C=C(/C)N.C=CN.CC.CC.
What is the InChIKey of (Z)-but-2-en-2-amine;ethane;ethenamine?
The InChIKey is QKEBQWLTRQHJPY-FGSKAQBVSA-N. The full InChI is InChI=1S/C4H9N.C2H5N.2C2H6/c1-3-4(2)5;1-2-3;2*1-2/h3H,5H2,1-2H3;2H,1,3H2;2*1-2H3/b4-3-;;;.
What are the key properties of (Z)-but-2-en-2-amine;ethane;ethenamine?
(Z)-but-2-en-2-amine;ethane;ethenamine has a molecular weight of 174.33 g/mol, XLogP of 3.01, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-but-2-en-2-amine;ethane;ethenamine is sourced from PubChem (CID 143379680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).