C13H30 — CID 143719744
ethane;(3Z)-3-methylpenta-1,3-diene;propane (PubChem CID 143719744) has the molecular formula C13H30 and a molecular weight of 186.38 g/mol. Its IUPAC name is ethane;(3Z)-3-methylpenta-1,3-diene;propane.
| Compound Name | ethane;(3Z)-3-methylpenta-1,3-diene;propane |
|---|---|
| PubChem CID | 143719744 |
| Molecular Formula | C13H30 |
| Molecular Weight | 186.38 g/mol |
| Exact Mass | 186.23 |
| IUPAC Name | ethane;(3Z)-3-methylpenta-1,3-diene;propane |
| SMILES | C=C/C(C)=C\C.CC.CC.CCC |
| InChI | InChI=1S/C6H10.C3H8.2C2H6/c1-4-6(3)5-2;1-3-2;2*1-2/h4-5H,1H2,2-3H3;3H2,1-2H3;2*1-2H3/b6-5-;;; |
| InChIKey | VAVOBAGIRBBVCC-WTUPQPTJSA-N |
| XLogP | 5.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.38 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|