C7H14S — CID 142804788
ethane;(1Z)-2-methylbuta-1,3-diene-1-thiol (PubChem CID 142804788) has the molecular formula C7H14S and a molecular weight of 130.26 g/mol. Its IUPAC name is ethane;(1Z)-2-methylbuta-1,3-diene-1-thiol.
| Compound Name | ethane;(1Z)-2-methylbuta-1,3-diene-1-thiol |
|---|---|
| PubChem CID | 142804788 |
| Molecular Formula | C7H14S |
| Molecular Weight | 130.26 g/mol |
| Exact Mass | 130.08 |
| IUPAC Name | ethane;(1Z)-2-methylbuta-1,3-diene-1-thiol |
| SMILES | C=C/C(C)=C\S.CC |
| InChI | InChI=1S/C5H8S.C2H6/c1-3-5(2)4-6;1-2/h3-4,6H,1H2,2H3;1-2H3/b5-4-; |
| InChIKey | MEFCFCHKJPDWSO-MKWAYWHRSA-N |
| XLogP | 3.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.26 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|