C5H8Pb — CID 173091187
2-methylbuta-1,3-dienyl-λ2-plumbane (PubChem CID 173091187) has the molecular formula C5H8Pb and a molecular weight of 275.32 g/mol. Its IUPAC name is 2-methylbuta-1,3-dienyl-λ2-plumbane.
| Compound Name | 2-methylbuta-1,3-dienyl-λ2-plumbane |
|---|---|
| PubChem CID | 173091187 |
| Molecular Formula | C5H8Pb |
| Molecular Weight | 275.32 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | 2-methylbuta-1,3-dienyl-λ2-plumbane |
| SMILES | C=CC(C)=C[PbH] |
| InChI | InChI=1S/C5H7.Pb.H/c1-4-5(2)3;;/h2,4H,1H2,3H3;; |
| InChIKey | WVQKKZJLXNWPOC-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.32 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|