About [(1E)-2-methylbuta-1,3-dienyl]phosphane
[(1E)-2-methylbuta-1,3-dienyl]phosphane (PubChem CID 118945946) has the molecular formula C5H9P
and a molecular weight of 100.10 g/mol. Its IUPAC name is [(1E)-2-methylbuta-1,3-dienyl]phosphane.
Molecular Properties
| Compound Name | [(1E)-2-methylbuta-1,3-dienyl]phosphane |
| PubChem CID | 118945946 |
| Molecular Formula | C5H9P |
| Molecular Weight | 100.10 g/mol |
| Exact Mass | 100.04 |
| IUPAC Name | [(1E)-2-methylbuta-1,3-dienyl]phosphane |
| SMILES | C=C/C(C)=C/P |
| InChI | InChI=1S/C5H9P/c1-3-5(2)4-6/h3-4H,1,6H2,2H3/b5-4+ |
| InChIKey | VMSOLAZCXHOALO-SNAWJCMRSA-N |
| XLogP | 1.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.10 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(1E)-2-methylbuta-1,3-dienyl]phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1E)-2-methylbuta-1,3-dienyl]phosphane?
The IUPAC name of [(1E)-2-methylbuta-1,3-dienyl]phosphane (CID 118945946) is [(1E)-2-methylbuta-1,3-dienyl]phosphane.
What is the SMILES notation for [(1E)-2-methylbuta-1,3-dienyl]phosphane?
The canonical SMILES for [(1E)-2-methylbuta-1,3-dienyl]phosphane is C=C/C(C)=C/P.
What is the InChIKey of [(1E)-2-methylbuta-1,3-dienyl]phosphane?
The InChIKey is VMSOLAZCXHOALO-SNAWJCMRSA-N. The full InChI is InChI=1S/C5H9P/c1-3-5(2)4-6/h3-4H,1,6H2,2H3/b5-4+.
What are the key properties of [(1E)-2-methylbuta-1,3-dienyl]phosphane?
[(1E)-2-methylbuta-1,3-dienyl]phosphane has a molecular weight of 100.10 g/mol, XLogP of 1.95, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(1E)-2-methylbuta-1,3-dienyl]phosphane is sourced from PubChem (CID 118945946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).