C5H9P — CID 118945946
[(1E)-2-methylbuta-1,3-dienyl]phosphane (PubChem CID 118945946) has the molecular formula C5H9P and a molecular weight of 100.10 g/mol. Its IUPAC name is [(1E)-2-methylbuta-1,3-dienyl]phosphane.
| Compound Name | [(1E)-2-methylbuta-1,3-dienyl]phosphane |
|---|---|
| PubChem CID | 118945946 |
| Molecular Formula | C5H9P |
| Molecular Weight | 100.10 g/mol |
| Exact Mass | 100.04 |
| IUPAC Name | [(1E)-2-methylbuta-1,3-dienyl]phosphane |
| SMILES | C=C/C(C)=C/P |
| InChI | InChI=1S/C5H9P/c1-3-5(2)4-6/h3-4H,1,6H2,2H3/b5-4+ |
| InChIKey | VMSOLAZCXHOALO-SNAWJCMRSA-N |
| XLogP | 1.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 100.10 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|