C6H10O — CID 534959
3-methylpenta-2,4-dien-1-ol (PubChem CID 534959) has the molecular formula C6H10O and a molecular weight of 98.14 g/mol. Its IUPAC name is 3-methylpenta-2,4-dien-1-ol.
| Compound Name | 3-methylpenta-2,4-dien-1-ol |
|---|---|
| PubChem CID | 534959 |
| Molecular Formula | C6H10O |
| Molecular Weight | 98.14 g/mol |
| Exact Mass | 98.07 |
| IUPAC Name | 3-methylpenta-2,4-dien-1-ol |
| SMILES | C=CC(C)=CCO |
| InChI | InChI=1S/C6H10O/c1-3-6(2)4-5-7/h3-4,7H,1,5H2,2H3 |
| InChIKey | MOBKGOLFIBXIOP-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 98.14 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|