C12H20 — CID 173395749
2-methylbuta-1,3-diene;(3E)-3-methylhexa-1,3-diene (PubChem CID 173395749) has the molecular formula C12H20 and a molecular weight of 164.29 g/mol. Its IUPAC name is 2-methylbuta-1,3-diene;(3E)-3-methylhexa-1,3-diene.
| Compound Name | 2-methylbuta-1,3-diene;(3E)-3-methylhexa-1,3-diene |
|---|---|
| PubChem CID | 173395749 |
| Molecular Formula | C12H20 |
| Molecular Weight | 164.29 g/mol |
| Exact Mass | 164.16 |
| IUPAC Name | 2-methylbuta-1,3-diene;(3E)-3-methylhexa-1,3-diene |
| SMILES | C=C/C(C)=C/CC.C=CC(=C)C |
| InChI | InChI=1S/C7H12.C5H8/c1-4-6-7(3)5-2;1-4-5(2)3/h5-6H,2,4H2,1,3H3;4H,1-2H2,3H3/b7-6+; |
| InChIKey | NJTBVQSANNHSAE-UHDJGPCESA-N |
| XLogP | 4.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.29 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|