About 2-methylbuta-1,3-diene;(3E)-3-methylhexa-1,3-diene
2-methylbuta-1,3-diene;(3E)-3-methylhexa-1,3-diene (PubChem CID 173395749) has the molecular formula C12H20
and a molecular weight of 164.29 g/mol. Its IUPAC name is 2-methylbuta-1,3-diene;(3E)-3-methylhexa-1,3-diene.
Molecular Properties
| Compound Name | 2-methylbuta-1,3-diene;(3E)-3-methylhexa-1,3-diene |
| PubChem CID | 173395749 |
| Molecular Formula | C12H20 |
| Molecular Weight | 164.29 g/mol |
| Exact Mass | 164.16 |
| IUPAC Name | 2-methylbuta-1,3-diene;(3E)-3-methylhexa-1,3-diene |
| SMILES | C=C/C(C)=C/CC.C=CC(=C)C |
| InChI | InChI=1S/C7H12.C5H8/c1-4-6-7(3)5-2;1-4-5(2)3/h5-6H,2,4H2,1,3H3;4H,1-2H2,3H3/b7-6+; |
| InChIKey | NJTBVQSANNHSAE-UHDJGPCESA-N |
| XLogP | 4.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.29 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbuta-1,3-diene;(3E)-3-methylhexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbuta-1,3-diene;(3E)-3-methylhexa-1,3-diene?
The IUPAC name of 2-methylbuta-1,3-diene;(3E)-3-methylhexa-1,3-diene (CID 173395749) is 2-methylbuta-1,3-diene;(3E)-3-methylhexa-1,3-diene.
What is the SMILES notation for 2-methylbuta-1,3-diene;(3E)-3-methylhexa-1,3-diene?
The canonical SMILES for 2-methylbuta-1,3-diene;(3E)-3-methylhexa-1,3-diene is C=C/C(C)=C/CC.C=CC(=C)C.
What is the InChIKey of 2-methylbuta-1,3-diene;(3E)-3-methylhexa-1,3-diene?
The InChIKey is NJTBVQSANNHSAE-UHDJGPCESA-N. The full InChI is InChI=1S/C7H12.C5H8/c1-4-6-7(3)5-2;1-4-5(2)3/h5-6H,2,4H2,1,3H3;4H,1-2H2,3H3/b7-6+;.
What are the key properties of 2-methylbuta-1,3-diene;(3E)-3-methylhexa-1,3-diene?
2-methylbuta-1,3-diene;(3E)-3-methylhexa-1,3-diene has a molecular weight of 164.29 g/mol, XLogP of 4.28, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbuta-1,3-diene;(3E)-3-methylhexa-1,3-diene is sourced from PubChem (CID 173395749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).