C17H32 — CID 160814683
3,3-dimethylpentane;bis(2-methylbuta-1,3-diene) (PubChem CID 160814683) has the molecular formula C17H32 and a molecular weight of 236.44 g/mol. Its IUPAC name is 3,3-dimethylpentane;bis(2-methylbuta-1,3-diene).
| Compound Name | 3,3-dimethylpentane;bis(2-methylbuta-1,3-diene) |
|---|---|
| PubChem CID | 160814683 |
| Molecular Formula | C17H32 |
| Molecular Weight | 236.44 g/mol |
| Exact Mass | 236.25 |
| IUPAC Name | 3,3-dimethylpentane;bis(2-methylbuta-1,3-diene) |
| SMILES | C=CC(=C)C.C=CC(=C)C.CCC(C)(C)CC |
| InChI | InChI=1S/C7H16.2C5H8/c1-5-7(3,4)6-2;2*1-4-5(2)3/h5-6H2,1-4H3;2*4H,1-2H2,3H3 |
| InChIKey | SETDFUVWIYXADV-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.44 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|