C6H9BrO — CID 138114565
5-bromo-3-methylpenta-2,4-dien-1-ol (PubChem CID 138114565) has the molecular formula C6H9BrO and a molecular weight of 177.04 g/mol. Its IUPAC name is 5-bromo-3-methylpenta-2,4-dien-1-ol.
| Compound Name | 5-bromo-3-methylpenta-2,4-dien-1-ol |
|---|---|
| PubChem CID | 138114565 |
| Molecular Formula | C6H9BrO |
| Molecular Weight | 177.04 g/mol |
| Exact Mass | 175.98 |
| IUPAC Name | 5-bromo-3-methylpenta-2,4-dien-1-ol |
| SMILES | CC(C=CBr)=CCO |
| InChI | InChI=1S/C6H9BrO/c1-6(2-4-7)3-5-8/h2-4,8H,5H2,1H3 |
| InChIKey | QQOSORLTDMXTRU-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.04 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|