About 5-bromo-3-methylpenta-2,4-dien-1-ol
5-bromo-3-methylpenta-2,4-dien-1-ol (PubChem CID 138114565) has the molecular formula C6H9BrO
and a molecular weight of 177.04 g/mol. Its IUPAC name is 5-bromo-3-methylpenta-2,4-dien-1-ol.
Molecular Properties
| Compound Name | 5-bromo-3-methylpenta-2,4-dien-1-ol |
| PubChem CID | 138114565 |
| Molecular Formula | C6H9BrO |
| Molecular Weight | 177.04 g/mol |
| Exact Mass | 175.98 |
| IUPAC Name | 5-bromo-3-methylpenta-2,4-dien-1-ol |
| SMILES | CC(C=CBr)=CCO |
| InChI | InChI=1S/C6H9BrO/c1-6(2-4-7)3-5-8/h2-4,8H,5H2,1H3 |
| InChIKey | QQOSORLTDMXTRU-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.04 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-3-methylpenta-2,4-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3-methylpenta-2,4-dien-1-ol?
The IUPAC name of 5-bromo-3-methylpenta-2,4-dien-1-ol (CID 138114565) is 5-bromo-3-methylpenta-2,4-dien-1-ol.
What is the SMILES notation for 5-bromo-3-methylpenta-2,4-dien-1-ol?
The canonical SMILES for 5-bromo-3-methylpenta-2,4-dien-1-ol is CC(C=CBr)=CCO.
What is the InChIKey of 5-bromo-3-methylpenta-2,4-dien-1-ol?
The InChIKey is QQOSORLTDMXTRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9BrO/c1-6(2-4-7)3-5-8/h2-4,8H,5H2,1H3.
What are the key properties of 5-bromo-3-methylpenta-2,4-dien-1-ol?
5-bromo-3-methylpenta-2,4-dien-1-ol has a molecular weight of 177.04 g/mol, XLogP of 1.83, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3-methylpenta-2,4-dien-1-ol is sourced from PubChem (CID 138114565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).