C18H30O3 — CID 174409871
8-(8-hydroxy-6-methylocta-4,6-dienoxy)-3-methylocta-2,4-dien-1-ol (PubChem CID 174409871) has the molecular formula C18H30O3 and a molecular weight of 294.44 g/mol. Its IUPAC name is 8-(8-hydroxy-6-methylocta-4,6-dienoxy)-3-methylocta-2,4-dien-1-ol.
| Compound Name | 8-(8-hydroxy-6-methylocta-4,6-dienoxy)-3-methylocta-2,4-dien-1-ol |
|---|---|
| PubChem CID | 174409871 |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | 8-(8-hydroxy-6-methylocta-4,6-dienoxy)-3-methylocta-2,4-dien-1-ol |
| SMILES | CC(C=CCCCOCCCC=CC(C)=CCO)=CCO |
| InChI | InChI=1S/C18H30O3/c1-17(11-13-19)9-5-3-7-15-21-16-8-4-6-10-18(2)12-14-20/h5-6,9-12,19-20H,3-4,7-8,13-16H2,1-2H3 |
| InChIKey | JVZUWZXINIWNFF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|