C16H26O — CID 152779167
(4E)-3-methyl-5-(2,2,6-trimethyl-1-bicyclo[4.1.0]heptanyl)penta-2,4-dien-1-ol (PubChem CID 152779167) has the molecular formula C16H26O and a molecular weight of 234.38 g/mol. Its IUPAC name is (4E)-3-methyl-5-(2,2,6-trimethyl-1-bicyclo[4.1.0]heptanyl)penta-2,4-dien-1-ol.
| Compound Name | (4E)-3-methyl-5-(2,2,6-trimethyl-1-bicyclo[4.1.0]heptanyl)penta-2,4-dien-1-ol |
|---|---|
| PubChem CID | 152779167 |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | (4E)-3-methyl-5-(2,2,6-trimethyl-1-bicyclo[4.1.0]heptanyl)penta-2,4-dien-1-ol |
| SMILES | CC(=CCO)/C=C/C12CC1(C)CCCC2(C)C |
| InChI | InChI=1S/C16H26O/c1-13(7-11-17)6-10-16-12-15(16,4)9-5-8-14(16,2)3/h6-7,10,17H,5,8-9,11-12H2,1-4H3/b10-6+,13-7? |
| InChIKey | NYJRXNLMURKVEW-DTCVOIPYSA-N |
| XLogP | 4.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|