C15H24O3 — CID 11470764
(1R,2R,4S)-1-[(1E,3E)-5-hydroxy-3-methylpenta-1,3-dienyl]-2,6,6-trimethyl-7-oxabicyclo[2.2.1]heptan-2-ol (PubChem CID 11470764) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is (1R,2R,4S)-1-[(1E,3E)-5-hydroxy-3-methylpenta-1,3-dienyl]-2,6,6-trimethyl-7-oxabicyclo[2.2.1]heptan-2-ol.
| Compound Name | (1R,2R,4S)-1-[(1E,3E)-5-hydroxy-3-methylpenta-1,3-dienyl]-2,6,6-trimethyl-7-oxabicyclo[2.2.1]heptan-2-ol |
|---|---|
| PubChem CID | 11470764 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (1R,2R,4S)-1-[(1E,3E)-5-hydroxy-3-methylpenta-1,3-dienyl]-2,6,6-trimethyl-7-oxabicyclo[2.2.1]heptan-2-ol |
| SMILES | CC(/C=C/[C@@]12O[C@@H](CC1(C)C)C[C@@]2(C)O)=C\CO |
| InChI | InChI=1S/C15H24O3/c1-11(6-8-16)5-7-15-13(2,3)9-12(18-15)10-14(15,4)17/h5-7,12,16-17H,8-10H2,1-4H3/b7-5+,11-6+/t12-,14+,15+/m0/s1 |
| InChIKey | RVQAZGORUYWWJU-NTXDHWKJSA-N |
| XLogP | 2.19 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|