C10H16O3 — CID 88826789
2,6-dimethylocta-2,4,6-triene-1,1,8-triol (PubChem CID 88826789) has the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. Its IUPAC name is 2,6-dimethylocta-2,4,6-triene-1,1,8-triol.
| Compound Name | 2,6-dimethylocta-2,4,6-triene-1,1,8-triol |
|---|---|
| PubChem CID | 88826789 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | 2,6-dimethylocta-2,4,6-triene-1,1,8-triol |
| SMILES | CC(C=CC=C(C)C(O)O)=CCO |
| InChI | InChI=1S/C10H16O3/c1-8(6-7-11)4-3-5-9(2)10(12)13/h3-6,10-13H,7H2,1-2H3 |
| InChIKey | YKSNFILYEYDJHT-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|