C22H32O — CID 58633476
(2E,4E,6E,8E,10E,12E,14E)-2,6,11,15,16-pentamethylheptadeca-2,4,6,8,10,12,14-heptaen-1-ol (PubChem CID 58633476) has the molecular formula C22H32O and a molecular weight of 312.50 g/mol. Its IUPAC name is (2E,4E,6E,8E,10E,12E,14E)-2,6,11,15,16-pentamethylheptadeca-2,4,6,8,10,12,14-heptaen-1-ol.
| Compound Name | (2E,4E,6E,8E,10E,12E,14E)-2,6,11,15,16-pentamethylheptadeca-2,4,6,8,10,12,14-heptaen-1-ol |
|---|---|
| PubChem CID | 58633476 |
| Molecular Formula | C22H32O |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | (2E,4E,6E,8E,10E,12E,14E)-2,6,11,15,16-pentamethylheptadeca-2,4,6,8,10,12,14-heptaen-1-ol |
| SMILES | CC(/C=C/C=C(\C)CO)=C\C=C\C=C(C)\C=C\C=C(/C)C(C)C |
| InChI | InChI=1S/C22H32O/c1-18(2)22(6)16-10-14-20(4)12-8-7-11-19(3)13-9-15-21(5)17-23/h7-16,18,23H,17H2,1-6H3/b8-7+,13-9+,14-10+,19-11+,20-12+,21-15+,22-16+ |
| InChIKey | OFTYHTOPHGYTGK-KKTGUBQVSA-N |
| XLogP | 6.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|