C6H10O2 — CID 142275116
(2E)-2-methylpenta-2,4-diene-1,1-diol (PubChem CID 142275116) has the molecular formula C6H10O2 and a molecular weight of 114.14 g/mol. Its IUPAC name is (2E)-2-methylpenta-2,4-diene-1,1-diol.
| Compound Name | (2E)-2-methylpenta-2,4-diene-1,1-diol |
|---|---|
| PubChem CID | 142275116 |
| Molecular Formula | C6H10O2 |
| Molecular Weight | 114.14 g/mol |
| Exact Mass | 114.07 |
| IUPAC Name | (2E)-2-methylpenta-2,4-diene-1,1-diol |
| SMILES | C=C/C=C(\C)C(O)O |
| InChI | InChI=1S/C6H10O2/c1-3-4-5(2)6(7)8/h3-4,6-8H,1H2,2H3/b5-4+ |
| InChIKey | DKTNIVRUUCDUBC-SNAWJCMRSA-N |
| XLogP | 0.43 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.14 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|