C7H13NO — CID 134266797
(2E)-2-methyl-1-(methylamino)penta-2,4-dien-1-ol (PubChem CID 134266797) has the molecular formula C7H13NO and a molecular weight of 127.19 g/mol. Its IUPAC name is (2E)-2-methyl-1-(methylamino)penta-2,4-dien-1-ol.
| Compound Name | (2E)-2-methyl-1-(methylamino)penta-2,4-dien-1-ol |
|---|---|
| PubChem CID | 134266797 |
| Molecular Formula | C7H13NO |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | (2E)-2-methyl-1-(methylamino)penta-2,4-dien-1-ol |
| SMILES | C=C/C=C(\C)C(O)NC |
| InChI | InChI=1S/C7H13NO/c1-4-5-6(2)7(9)8-3/h4-5,7-9H,1H2,2-3H3/b6-5+ |
| InChIKey | CDFZFYJRPHIQKY-AATRIKPKSA-N |
| XLogP | 0.66 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|