C10H20O — CID 142879851
butane;(3E)-4-methoxypenta-1,3-diene (PubChem CID 142879851) has the molecular formula C10H20O and a molecular weight of 156.27 g/mol. Its IUPAC name is butane;(3E)-4-methoxypenta-1,3-diene.
| Compound Name | butane;(3E)-4-methoxypenta-1,3-diene |
|---|---|
| PubChem CID | 142879851 |
| Molecular Formula | C10H20O |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.15 |
| IUPAC Name | butane;(3E)-4-methoxypenta-1,3-diene |
| SMILES | C=C/C=C(\C)OC.CCCC |
| InChI | InChI=1S/C6H10O.C4H10/c1-4-5-6(2)7-3;1-3-4-2/h4-5H,1H2,2-3H3;3-4H2,1-2H3/b6-5+; |
| InChIKey | QCBQNIASVCUDQL-IPZCTEOASA-N |
| XLogP | 3.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|