C10H21NO — CID 142050769
butane;(2E)-N-methoxypenta-2,4-dien-2-amine (PubChem CID 142050769) has the molecular formula C10H21NO and a molecular weight of 171.28 g/mol. Its IUPAC name is butane;(2E)-N-methoxypenta-2,4-dien-2-amine.
| Compound Name | butane;(2E)-N-methoxypenta-2,4-dien-2-amine |
|---|---|
| PubChem CID | 142050769 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | butane;(2E)-N-methoxypenta-2,4-dien-2-amine |
| SMILES | C=C/C=C(\C)NOC.CCCC |
| InChI | InChI=1S/C6H11NO.C4H10/c1-4-5-6(2)7-8-3;1-3-4-2/h4-5,7H,1H2,2-3H3;3-4H2,1-2H3/b6-5+; |
| InChIKey | CZZJNAPMWVFOMW-IPZCTEOASA-N |
| XLogP | 3.03 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|