C10H18O2 — CID 144684932
(3Z)-3-methoxyhexa-3,5-dien-2-one;propane (PubChem CID 144684932) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is (3Z)-3-methoxyhexa-3,5-dien-2-one;propane.
| Compound Name | (3Z)-3-methoxyhexa-3,5-dien-2-one;propane |
|---|---|
| PubChem CID | 144684932 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | (3Z)-3-methoxyhexa-3,5-dien-2-one;propane |
| SMILES | C=C/C=C(\OC)C(C)=O.CCC |
| InChI | InChI=1S/C7H10O2.C3H8/c1-4-5-7(9-3)6(2)8;1-3-2/h4-5H,1H2,2-3H3;3H2,1-2H3/b7-5-; |
| InChIKey | BICLMNDSZXTSKU-YJOCEBFMSA-N |
| XLogP | 2.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|