C9H14O3 — CID 145301395
(2E,4E)-3,4-dimethoxyhepta-2,4,6-trien-1-ol (PubChem CID 145301395) has the molecular formula C9H14O3 and a molecular weight of 170.21 g/mol. Its IUPAC name is (2E,4E)-3,4-dimethoxyhepta-2,4,6-trien-1-ol.
| Compound Name | (2E,4E)-3,4-dimethoxyhepta-2,4,6-trien-1-ol |
|---|---|
| PubChem CID | 145301395 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | (2E,4E)-3,4-dimethoxyhepta-2,4,6-trien-1-ol |
| SMILES | C=C/C=C(OC)\C(=C/CO)OC |
| InChI | InChI=1S/C9H14O3/c1-4-5-8(11-2)9(12-3)6-7-10/h4-6,10H,1,7H2,2-3H3/b8-5+,9-6+ |
| InChIKey | PMYCNJWUMZCXAN-XVYDYJIPSA-N |
| XLogP | 1.23 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|