C11H16O2 — CID 143496592
(3E,5E)-4-ethoxy-5-methoxyocta-1,3,5,7-tetraene (PubChem CID 143496592) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is (3E,5E)-4-ethoxy-5-methoxyocta-1,3,5,7-tetraene.
| Compound Name | (3E,5E)-4-ethoxy-5-methoxyocta-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 143496592 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | (3E,5E)-4-ethoxy-5-methoxyocta-1,3,5,7-tetraene |
| SMILES | C=C/C=C(OC)\C(=C/C=C)OCC |
| InChI | InChI=1S/C11H16O2/c1-5-8-10(12-4)11(9-6-2)13-7-3/h5-6,8-9H,1-2,7H2,3-4H3/b10-8+,11-9+ |
| InChIKey | LABBXEHMCCOAMW-GFULKKFKSA-N |
| XLogP | 2.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|