C12H20O — CID 143486696
(3E,5Z)-4-ethoxy-5-ethylideneocta-1,3-diene (PubChem CID 143486696) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is (3E,5Z)-4-ethoxy-5-ethylideneocta-1,3-diene.
| Compound Name | (3E,5Z)-4-ethoxy-5-ethylideneocta-1,3-diene |
|---|---|
| PubChem CID | 143486696 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | (3E,5Z)-4-ethoxy-5-ethylideneocta-1,3-diene |
| SMILES | C=C/C=C(OCC)\C(=C/C)CCC |
| InChI | InChI=1S/C12H20O/c1-5-9-11(7-3)12(10-6-2)13-8-4/h6-7,10H,2,5,8-9H2,1,3-4H3/b11-7-,12-10+ |
| InChIKey | BBROLHQUHIFIQV-OMCDNRFESA-N |
| XLogP | 3.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|