C20H32O5 — CID 162428628
[(3Z,4E)-4-[3,3-bis(hydroxymethyl)pentoxy]-3-ethylidenehepta-4,6-dienyl] 2-methylprop-2-enoate (PubChem CID 162428628) has the molecular formula C20H32O5 and a molecular weight of 352.47 g/mol. Its IUPAC name is [(3Z,4E)-4-[3,3-bis(hydroxymethyl)pentoxy]-3-ethylidenehepta-4,6-dienyl] 2-methylprop-2-enoate.
| Compound Name | [(3Z,4E)-4-[3,3-bis(hydroxymethyl)pentoxy]-3-ethylidenehepta-4,6-dienyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 162428628 |
| Molecular Formula | C20H32O5 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | [(3Z,4E)-4-[3,3-bis(hydroxymethyl)pentoxy]-3-ethylidenehepta-4,6-dienyl] 2-methylprop-2-enoate |
| SMILES | C=C/C=C(OCCC(CC)(CO)CO)\C(=C/C)CCOC(=O)C(=C)C |
| InChI | InChI=1S/C20H32O5/c1-6-9-18(24-13-11-20(8-3,14-21)15-22)17(7-2)10-12-25-19(23)16(4)5/h6-7,9,21-22H,1,4,8,10-15H2,2-3,5H3/b17-7-,18-9+ |
| InChIKey | ZPRMBXFEZKBTKM-IHNUGBPVSA-N |
| XLogP | 3.30 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|