C18H36O6 — CID 157244927
2,2-bis(hydroxymethyl)propane-1,3-diol;nonyl 2-methylprop-2-enoate (PubChem CID 157244927) has the molecular formula C18H36O6 and a molecular weight of 348.48 g/mol. Its IUPAC name is 2,2-bis(hydroxymethyl)propane-1,3-diol;nonyl 2-methylprop-2-enoate.
| Compound Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;nonyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 157244927 |
| Molecular Formula | C18H36O6 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;nonyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCCCC.OCC(CO)(CO)CO |
| InChI | InChI=1S/C13H24O2.C5H12O4/c1-4-5-6-7-8-9-10-11-15-13(14)12(2)3;6-1-5(2-7,3-8)4-9/h2,4-11H2,1,3H3;6-9H,1-4H2 |
| InChIKey | AVQLYFCGIFLTTA-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|