C22H38 — CID 166119091
bis(but-1-ene);(4Z,6E,8Z)-8-ethylidene-7-methylundeca-2,4,6-triene (PubChem CID 166119091) has the molecular formula C22H38 and a molecular weight of 302.55 g/mol. Its IUPAC name is bis(but-1-ene);(4Z,6E,8Z)-8-ethylidene-7-methylundeca-2,4,6-triene.
| Compound Name | bis(but-1-ene);(4Z,6E,8Z)-8-ethylidene-7-methylundeca-2,4,6-triene |
|---|---|
| PubChem CID | 166119091 |
| Molecular Formula | C22H38 |
| Molecular Weight | 302.55 g/mol |
| Exact Mass | 302.30 |
| IUPAC Name | bis(but-1-ene);(4Z,6E,8Z)-8-ethylidene-7-methylundeca-2,4,6-triene |
| SMILES | C=CCC.C=CCC.CC=C/C=C\C=C(C)\C(=C/C)CCC |
| InChI | InChI=1S/C14H22.2C4H8/c1-5-8-9-10-12-13(4)14(7-3)11-6-2;2*1-3-4-2/h5,7-10,12H,6,11H2,1-4H3;2*3H,1,4H2,2H3/b8-5?,10-9-,13-12+,14-7-;; |
| InChIKey | WRKDJRBRZZSVOE-PMRHQNNLSA-N |
| XLogP | 7.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.55 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|