C15H24O — CID 157029052
(2Z,4E,6Z)-3-ethyl-4-methyl-2-propylnona-2,4,6,8-tetraen-1-ol (PubChem CID 157029052) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is (2Z,4E,6Z)-3-ethyl-4-methyl-2-propylnona-2,4,6,8-tetraen-1-ol.
| Compound Name | (2Z,4E,6Z)-3-ethyl-4-methyl-2-propylnona-2,4,6,8-tetraen-1-ol |
|---|---|
| PubChem CID | 157029052 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | (2Z,4E,6Z)-3-ethyl-4-methyl-2-propylnona-2,4,6,8-tetraen-1-ol |
| SMILES | C=C/C=C\C=C(C)\C(CC)=C(/CO)CCC |
| InChI | InChI=1S/C15H24O/c1-5-8-9-11-13(4)15(7-3)14(12-16)10-6-2/h5,8-9,11,16H,1,6-7,10,12H2,2-4H3/b9-8-,13-11+,15-14- |
| InChIKey | LMDQTKHIGPGQMH-USMRHOHYSA-N |
| XLogP | 4.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|