C10H15Br — CID 146617133
(1E,3Z)-1-bromo-4-methyl-5-methylideneocta-1,3-diene (PubChem CID 146617133) has the molecular formula C10H15Br and a molecular weight of 215.13 g/mol. Its IUPAC name is (1E,3Z)-1-bromo-4-methyl-5-methylideneocta-1,3-diene.
| Compound Name | (1E,3Z)-1-bromo-4-methyl-5-methylideneocta-1,3-diene |
|---|---|
| PubChem CID | 146617133 |
| Molecular Formula | C10H15Br |
| Molecular Weight | 215.13 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | (1E,3Z)-1-bromo-4-methyl-5-methylideneocta-1,3-diene |
| SMILES | C=C(CCC)/C(C)=C\C=C\Br |
| InChI | InChI=1S/C10H15Br/c1-4-6-9(2)10(3)7-5-8-11/h5,7-8H,2,4,6H2,1,3H3/b8-5+,10-7- |
| InChIKey | NCDHLKNUAMPPFZ-HAMFBJRISA-N |
| XLogP | 4.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.13 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|