C14H24 — CID 143693858
(2Z,4Z)-5-methyl-6-methylidenedodeca-2,4-diene (PubChem CID 143693858) has the molecular formula C14H24 and a molecular weight of 192.35 g/mol. Its IUPAC name is (2Z,4Z)-5-methyl-6-methylidenedodeca-2,4-diene.
| Compound Name | (2Z,4Z)-5-methyl-6-methylidenedodeca-2,4-diene |
|---|---|
| PubChem CID | 143693858 |
| Molecular Formula | C14H24 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.19 |
| IUPAC Name | (2Z,4Z)-5-methyl-6-methylidenedodeca-2,4-diene |
| SMILES | C=C(CCCCCC)/C(C)=C\C=C/C |
| InChI | InChI=1S/C14H24/c1-5-7-9-10-12-14(4)13(3)11-8-6-2/h6,8,11H,4-5,7,9-10,12H2,1-3H3/b8-6-,13-11- |
| InChIKey | ASOBVKHKQQFUHD-MJQGXCIASA-N |
| XLogP | 5.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|