C16H30 — CID 16741365
(6E,8E)-6,9-dimethyltetradeca-6,8-diene (PubChem CID 16741365) has the molecular formula C16H30 and a molecular weight of 222.42 g/mol. Its IUPAC name is (6E,8E)-6,9-dimethyltetradeca-6,8-diene.
| Compound Name | (6E,8E)-6,9-dimethyltetradeca-6,8-diene |
|---|---|
| PubChem CID | 16741365 |
| Molecular Formula | C16H30 |
| Molecular Weight | 222.42 g/mol |
| Exact Mass | 222.23 |
| IUPAC Name | (6E,8E)-6,9-dimethyltetradeca-6,8-diene |
| SMILES | CCCCC/C(C)=C/C=C(\C)CCCCC |
| InChI | InChI=1S/C16H30/c1-5-7-9-11-15(3)13-14-16(4)12-10-8-6-2/h13-14H,5-12H2,1-4H3/b15-13+,16-14+ |
| InChIKey | ZOPHQQHPFZCTBT-WXUKJITCSA-N |
| XLogP | 6.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.42 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|