C6H12O3 — CID 172738062
2-propylprop-1-ene-1,1,3-triol (PubChem CID 172738062) has the molecular formula C6H12O3 and a molecular weight of 132.16 g/mol. Its IUPAC name is 2-propylprop-1-ene-1,1,3-triol.
| Compound Name | 2-propylprop-1-ene-1,1,3-triol |
|---|---|
| PubChem CID | 172738062 |
| Molecular Formula | C6H12O3 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.08 |
| IUPAC Name | 2-propylprop-1-ene-1,1,3-triol |
| SMILES | CCCC(CO)=C(O)O |
| InChI | InChI=1S/C6H12O3/c1-2-3-5(4-7)6(8)9/h7-9H,2-4H2,1H3 |
| InChIKey | ISELVLKPWCLOAN-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|