C11H18 — CID 166467413
(Z,5Z)-5-ethylidene-4-methylideneoct-2-ene (PubChem CID 166467413) has the molecular formula C11H18 and a molecular weight of 150.26 g/mol. Its IUPAC name is (Z,5Z)-5-ethylidene-4-methylideneoct-2-ene.
| Compound Name | (Z,5Z)-5-ethylidene-4-methylideneoct-2-ene |
|---|---|
| PubChem CID | 166467413 |
| Molecular Formula | C11H18 |
| Molecular Weight | 150.26 g/mol |
| Exact Mass | 150.14 |
| IUPAC Name | (Z,5Z)-5-ethylidene-4-methylideneoct-2-ene |
| SMILES | C=C(/C=C\C)/C(=C\C)CCC |
| InChI | InChI=1S/C11H18/c1-5-8-10(4)11(7-3)9-6-2/h5,7-8H,4,6,9H2,1-3H3/b8-5-,11-7- |
| InChIKey | PMXFXWKQFZGDAY-XCSPDYBASA-N |
| XLogP | 3.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.26 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|