C13H22O — CID 143778379
ethane;(2E,3Z)-2-ethylidene-3-propylhexa-3,5-dienal (PubChem CID 143778379) has the molecular formula C13H22O and a molecular weight of 194.32 g/mol. Its IUPAC name is ethane;(2E,3Z)-2-ethylidene-3-propylhexa-3,5-dienal.
| Compound Name | ethane;(2E,3Z)-2-ethylidene-3-propylhexa-3,5-dienal |
|---|---|
| PubChem CID | 143778379 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | ethane;(2E,3Z)-2-ethylidene-3-propylhexa-3,5-dienal |
| SMILES | C=C/C=C(CCC)\C(C=O)=C/C.CC |
| InChI | InChI=1S/C11H16O.C2H6/c1-4-7-11(8-5-2)10(6-3)9-12;1-2/h4,6-7,9H,1,5,8H2,2-3H3;1-2H3/b10-6-,11-7-; |
| InChIKey | VNRYUKCNGRYZKO-PKBOVVSKSA-N |
| XLogP | 4.07 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|