C9H12O2S — CID 135199697
(2Z,3E)-2-ethylidene-3-methoxysulfanylhexa-3,5-dienal (PubChem CID 135199697) has the molecular formula C9H12O2S and a molecular weight of 184.26 g/mol. Its IUPAC name is (2Z,3E)-2-ethylidene-3-methoxysulfanylhexa-3,5-dienal.
| Compound Name | (2Z,3E)-2-ethylidene-3-methoxysulfanylhexa-3,5-dienal |
|---|---|
| PubChem CID | 135199697 |
| Molecular Formula | C9H12O2S |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | (2Z,3E)-2-ethylidene-3-methoxysulfanylhexa-3,5-dienal |
| SMILES | C=C/C=C(SOC)\C(C=O)=C/C |
| InChI | InChI=1S/C9H12O2S/c1-4-6-9(12-11-3)8(5-2)7-10/h4-7H,1H2,2-3H3/b8-5-,9-6+ |
| InChIKey | BGCYKGQTGCSVRL-LDFAFZTOSA-N |
| XLogP | 2.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|