C14H14O2S2 — CID 143612783
(2Z)-2-[1-[[(3Z)-3-formylhexa-1,3,5-trien-2-yl]disulfanyl]ethenyl]penta-2,4-dienal (PubChem CID 143612783) has the molecular formula C14H14O2S2 and a molecular weight of 278.40 g/mol. Its IUPAC name is (2Z)-2-[1-[[(3Z)-3-formylhexa-1,3,5-trien-2-yl]disulfanyl]ethenyl]penta-2,4-dienal.
| Compound Name | (2Z)-2-[1-[[(3Z)-3-formylhexa-1,3,5-trien-2-yl]disulfanyl]ethenyl]penta-2,4-dienal |
|---|---|
| PubChem CID | 143612783 |
| Molecular Formula | C14H14O2S2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | (2Z)-2-[1-[[(3Z)-3-formylhexa-1,3,5-trien-2-yl]disulfanyl]ethenyl]penta-2,4-dienal |
| SMILES | C=C/C=C(/C=O)C(=C)SSC(=C)/C(C=O)=C\C=C |
| InChI | InChI=1S/C14H14O2S2/c1-5-7-13(9-15)11(3)17-18-12(4)14(10-16)8-6-2/h5-10H,1-4H2/b13-7-,14-8- |
| InChIKey | BSXUMYYXUDOZJU-PVRNWPCDSA-N |
| XLogP | 4.02 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|