C9H8O3 — CID 166653083
(3Z)-hexa-1,3,5-triene-1,1,3-tricarbaldehyde (PubChem CID 166653083) has the molecular formula C9H8O3 and a molecular weight of 164.16 g/mol. Its IUPAC name is (3Z)-hexa-1,3,5-triene-1,1,3-tricarbaldehyde.
| Compound Name | (3Z)-hexa-1,3,5-triene-1,1,3-tricarbaldehyde |
|---|---|
| PubChem CID | 166653083 |
| Molecular Formula | C9H8O3 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.05 |
| IUPAC Name | (3Z)-hexa-1,3,5-triene-1,1,3-tricarbaldehyde |
| SMILES | C=C/C=C(\C=O)C=C(C=O)C=O |
| InChI | InChI=1S/C9H8O3/c1-2-3-8(5-10)4-9(6-11)7-12/h2-7H,1H2/b8-3- |
| InChIKey | CBMIFRLIPLAXSO-BAQGIRSFSA-N |
| XLogP | 0.62 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|