C11H11FO2 — CID 126761936
(2Z,4E,5Z)-2-fluoro-4-prop-2-enylideneocta-2,5,7-trienoic acid (PubChem CID 126761936) has the molecular formula C11H11FO2 and a molecular weight of 194.20 g/mol. Its IUPAC name is (2Z,4E,5Z)-2-fluoro-4-prop-2-enylideneocta-2,5,7-trienoic acid.
| Compound Name | (2Z,4E,5Z)-2-fluoro-4-prop-2-enylideneocta-2,5,7-trienoic acid |
|---|---|
| PubChem CID | 126761936 |
| Molecular Formula | C11H11FO2 |
| Molecular Weight | 194.20 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | (2Z,4E,5Z)-2-fluoro-4-prop-2-enylideneocta-2,5,7-trienoic acid |
| SMILES | C=C/C=C\C(\C=C(/F)C(=O)O)=C/C=C |
| InChI | InChI=1S/C11H11FO2/c1-3-5-7-9(6-4-2)8-10(12)11(13)14/h3-8H,1-2H2,(H,13,14)/b7-5-,9-6+,10-8- |
| InChIKey | DRTAIKRDBIGEFJ-WGXSJNKASA-N |
| XLogP | 2.78 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.20 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|