C11H12O2 — CID 101443501
(3E,6Z,8E)-7-hydroxyundeca-1,3,6,8,10-pentaen-5-one (PubChem CID 101443501) has the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. Its IUPAC name is (3E,6Z,8E)-7-hydroxyundeca-1,3,6,8,10-pentaen-5-one.
| Compound Name | (3E,6Z,8E)-7-hydroxyundeca-1,3,6,8,10-pentaen-5-one |
|---|---|
| PubChem CID | 101443501 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | (3E,6Z,8E)-7-hydroxyundeca-1,3,6,8,10-pentaen-5-one |
| SMILES | C=C/C=C/C(=O)/C=C(O)/C=C/C=C |
| InChI | InChI=1S/C11H12O2/c1-3-5-7-10(12)9-11(13)8-6-4-2/h3-9,12H,1-2H2/b7-5+,8-6+,10-9- |
| InChIKey | NZJXZSQEFKOQTF-NYRUCRBQSA-N |
| XLogP | 2.48 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|