C7H10O3 — CID 87513549
2-methylidenehexa-3,5-dienoic acid;hydrate (PubChem CID 87513549) has the molecular formula C7H10O3 and a molecular weight of 142.15 g/mol. Its IUPAC name is 2-methylidenehexa-3,5-dienoic acid;hydrate.
| Compound Name | 2-methylidenehexa-3,5-dienoic acid;hydrate |
|---|---|
| PubChem CID | 87513549 |
| Molecular Formula | C7H10O3 |
| Molecular Weight | 142.15 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | 2-methylidenehexa-3,5-dienoic acid;hydrate |
| SMILES | C=CC=CC(=C)C(=O)O.O |
| InChI | InChI=1S/C7H8O2.H2O/c1-3-4-5-6(2)7(8)9;/h3-5H,1-2H2,(H,8,9);1H2 |
| InChIKey | XLZUICFBERHKTM-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 68.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.15 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|