About (2E,5Z)-2-hydroxyimino-4-methylidene-3-oxoocta-5,7-dienenitrile
(2E,5Z)-2-hydroxyimino-4-methylidene-3-oxoocta-5,7-dienenitrile (PubChem CID 122417655) has the molecular formula C9H8N2O2
and a molecular weight of 176.17 g/mol. Its IUPAC name is (2E,5Z)-2-hydroxyimino-4-methylidene-3-oxoocta-5,7-dienenitrile.
Molecular Properties
| Compound Name | (2E,5Z)-2-hydroxyimino-4-methylidene-3-oxoocta-5,7-dienenitrile |
| PubChem CID | 122417655 |
| Molecular Formula | C9H8N2O2 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | (2E,5Z)-2-hydroxyimino-4-methylidene-3-oxoocta-5,7-dienenitrile |
| SMILES | C=C/C=C\C(=C)C(=O)/C(C#N)=N/O |
| InChI | InChI=1S/C9H8N2O2/c1-3-4-5-7(2)9(12)8(6-10)11-13/h3-5,13H,1-2H2/b5-4-,11-8+ |
| InChIKey | VUQQYKVSGJEMRZ-LGXSBLIVSA-N |
| XLogP | 1.21 |
| TPSA | 73.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2E,5Z)-2-hydroxyimino-4-methylidene-3-oxoocta-5,7-dienenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,5Z)-2-hydroxyimino-4-methylidene-3-oxoocta-5,7-dienenitrile?
The IUPAC name of (2E,5Z)-2-hydroxyimino-4-methylidene-3-oxoocta-5,7-dienenitrile (CID 122417655) is (2E,5Z)-2-hydroxyimino-4-methylidene-3-oxoocta-5,7-dienenitrile.
What is the SMILES notation for (2E,5Z)-2-hydroxyimino-4-methylidene-3-oxoocta-5,7-dienenitrile?
The canonical SMILES for (2E,5Z)-2-hydroxyimino-4-methylidene-3-oxoocta-5,7-dienenitrile is C=C/C=C\C(=C)C(=O)/C(C#N)=N/O.
What is the InChIKey of (2E,5Z)-2-hydroxyimino-4-methylidene-3-oxoocta-5,7-dienenitrile?
The InChIKey is VUQQYKVSGJEMRZ-LGXSBLIVSA-N. The full InChI is InChI=1S/C9H8N2O2/c1-3-4-5-7(2)9(12)8(6-10)11-13/h3-5,13H,1-2H2/b5-4-,11-8+.
What are the key properties of (2E,5Z)-2-hydroxyimino-4-methylidene-3-oxoocta-5,7-dienenitrile?
(2E,5Z)-2-hydroxyimino-4-methylidene-3-oxoocta-5,7-dienenitrile has a molecular weight of 176.17 g/mol, XLogP of 1.21, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,5Z)-2-hydroxyimino-4-methylidene-3-oxoocta-5,7-dienenitrile is sourced from PubChem (CID 122417655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).