C9H11N — CID 142026515
(3Z)-2-propan-2-ylidenehexa-3,5-dienenitrile (PubChem CID 142026515) has the molecular formula C9H11N and a molecular weight of 133.19 g/mol. Its IUPAC name is (3Z)-2-propan-2-ylidenehexa-3,5-dienenitrile.
| Compound Name | (3Z)-2-propan-2-ylidenehexa-3,5-dienenitrile |
|---|---|
| PubChem CID | 142026515 |
| Molecular Formula | C9H11N |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.09 |
| IUPAC Name | (3Z)-2-propan-2-ylidenehexa-3,5-dienenitrile |
| SMILES | C=C/C=C\C(C#N)=C(C)C |
| InChI | InChI=1S/C9H11N/c1-4-5-6-9(7-10)8(2)3/h4-6H,1H2,2-3H3/b6-5- |
| InChIKey | OJEAVQSSGHURES-WAYWQWQTSA-N |
| XLogP | 2.59 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|