C12H12N2 — CID 143427931
(2E,4E)-3-amino-2-[(E)-pent-2-en-4-yn-2-yl]hepta-2,4,6-trienenitrile (PubChem CID 143427931) has the molecular formula C12H12N2 and a molecular weight of 184.24 g/mol. Its IUPAC name is (2E,4E)-3-amino-2-[(E)-pent-2-en-4-yn-2-yl]hepta-2,4,6-trienenitrile.
| Compound Name | (2E,4E)-3-amino-2-[(E)-pent-2-en-4-yn-2-yl]hepta-2,4,6-trienenitrile |
|---|---|
| PubChem CID | 143427931 |
| Molecular Formula | C12H12N2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | (2E,4E)-3-amino-2-[(E)-pent-2-en-4-yn-2-yl]hepta-2,4,6-trienenitrile |
| SMILES | C#C/C=C(C)/C(C#N)=C(N)/C=C/C=C |
| InChI | InChI=1S/C12H12N2/c1-4-6-8-12(14)11(9-13)10(3)7-5-2/h2,4,6-8H,1,14H2,3H3/b8-6+,10-7+,12-11- |
| InChIKey | FAIKLAZBRVHVOR-UGZWLHIVSA-N |
| XLogP | 2.04 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|