C9H14O2 — CID 89381368
(3Z,5Z)-5,6-dimethoxyhepta-1,3,5-triene (PubChem CID 89381368) has the molecular formula C9H14O2 and a molecular weight of 154.21 g/mol. Its IUPAC name is (3Z,5Z)-5,6-dimethoxyhepta-1,3,5-triene.
| Compound Name | (3Z,5Z)-5,6-dimethoxyhepta-1,3,5-triene |
|---|---|
| PubChem CID | 89381368 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | (3Z,5Z)-5,6-dimethoxyhepta-1,3,5-triene |
| SMILES | C=C/C=C\C(OC)=C(/C)OC |
| InChI | InChI=1S/C9H14O2/c1-5-6-7-9(11-4)8(2)10-3/h5-7H,1H2,2-4H3/b7-6-,9-8- |
| InChIKey | KNGZNJGJMUBYLE-JPDBVBESSA-N |
| XLogP | 2.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|