C14H18O — CID 142839425
(3Z,7Z)-2-methoxy-3-methyl-5,6-dimethylidenedeca-1,3,7,9-tetraene (PubChem CID 142839425) has the molecular formula C14H18O and a molecular weight of 202.30 g/mol. Its IUPAC name is (3Z,7Z)-2-methoxy-3-methyl-5,6-dimethylidenedeca-1,3,7,9-tetraene.
| Compound Name | (3Z,7Z)-2-methoxy-3-methyl-5,6-dimethylidenedeca-1,3,7,9-tetraene |
|---|---|
| PubChem CID | 142839425 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | (3Z,7Z)-2-methoxy-3-methyl-5,6-dimethylidenedeca-1,3,7,9-tetraene |
| SMILES | C=C/C=C\C(=C)C(=C)/C=C(\C)C(=C)OC |
| InChI | InChI=1S/C14H18O/c1-7-8-9-11(2)12(3)10-13(4)14(5)15-6/h7-10H,1-3,5H2,4,6H3/b9-8-,13-10- |
| InChIKey | OPZFWYGBNXDRFI-AGMBNHQJSA-N |
| XLogP | 3.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|