C17H26O — CID 123743663
8-tert-butyl-7-methoxy-6-methyl-5-methylidenedeca-1,3,6,8-tetraene (PubChem CID 123743663) has the molecular formula C17H26O and a molecular weight of 246.39 g/mol. Its IUPAC name is 8-tert-butyl-7-methoxy-6-methyl-5-methylidenedeca-1,3,6,8-tetraene.
| Compound Name | 8-tert-butyl-7-methoxy-6-methyl-5-methylidenedeca-1,3,6,8-tetraene |
|---|---|
| PubChem CID | 123743663 |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | 8-tert-butyl-7-methoxy-6-methyl-5-methylidenedeca-1,3,6,8-tetraene |
| SMILES | C=CC=CC(=C)C(C)=C(OC)C(=CC)C(C)(C)C |
| InChI | InChI=1S/C17H26O/c1-9-11-12-13(3)14(4)16(18-8)15(10-2)17(5,6)7/h9-12H,1,3H2,2,4-8H3 |
| InChIKey | ZTJRINKZMLEQOA-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|