C17H33NO — CID 143947867
O-[(5Z)-5-tert-butyl-3-ethenylhepta-1,3,5-trien-4-yl]hydroxylamine;ethane (PubChem CID 143947867) has the molecular formula C17H33NO and a molecular weight of 267.46 g/mol. Its IUPAC name is O-[(5Z)-5-tert-butyl-3-ethenylhepta-1,3,5-trien-4-yl]hydroxylamine;ethane.
| Compound Name | O-[(5Z)-5-tert-butyl-3-ethenylhepta-1,3,5-trien-4-yl]hydroxylamine;ethane |
|---|---|
| PubChem CID | 143947867 |
| Molecular Formula | C17H33NO |
| Molecular Weight | 267.46 g/mol |
| Exact Mass | 267.26 |
| IUPAC Name | O-[(5Z)-5-tert-butyl-3-ethenylhepta-1,3,5-trien-4-yl]hydroxylamine;ethane |
| SMILES | C=CC(C=C)=C(ON)/C(=C\C)C(C)(C)C.CC.CC |
| InChI | InChI=1S/C13H21NO.2C2H6/c1-7-10(8-2)12(15-14)11(9-3)13(4,5)6;2*1-2/h7-9H,1-2,14H2,3-6H3;2*1-2H3/b11-9+;; |
| InChIKey | MFEOAHNKCSFCRQ-OTBYXNOXSA-N |
| XLogP | 5.55 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.46 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|