C11H19NO — CID 129140973
O-[(1Z,3Z)-2-tert-butyl-3-ethenylpenta-1,3-dienyl]hydroxylamine (PubChem CID 129140973) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is O-[(1Z,3Z)-2-tert-butyl-3-ethenylpenta-1,3-dienyl]hydroxylamine.
| Compound Name | O-[(1Z,3Z)-2-tert-butyl-3-ethenylpenta-1,3-dienyl]hydroxylamine |
|---|---|
| PubChem CID | 129140973 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | O-[(1Z,3Z)-2-tert-butyl-3-ethenylpenta-1,3-dienyl]hydroxylamine |
| SMILES | C=CC(=C/C)/C(=C\ON)C(C)(C)C |
| InChI | InChI=1S/C11H19NO/c1-6-9(7-2)10(8-13-12)11(3,4)5/h6-8H,1,12H2,2-5H3/b9-7-,10-8+ |
| InChIKey | VXDGUYBBPCRODI-FKJILZIQSA-N |
| XLogP | 2.94 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|